C16H16N4O3 — CID 176831201
methyl (2R)-2-[(2-amino-4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 176831201) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl (2R)-2-[(2-amino-4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2R)-2-[(2-amino-4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 176831201 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl (2R)-2-[(2-amino-4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | C#Cc1ccc(C(=O)N[C@H](Cc2cnc[nH]2)C(=O)OC)c(N)c1 |
| InChI | InChI=1S/C16H16N4O3/c1-3-10-4-5-12(13(17)6-10)15(21)20-14(16(22)23-2)7-11-8-18-9-19-11/h1,4-6,8-9,14H,7,17H2,2H3,(H,18,19)(H,20,21)/t14-/m1/s1 |
| InChIKey | BMQDUJOCEICQDB-CQSZACIVSA-N |
| XLogP | 0.49 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|