C19H21N3O3 — CID 176831019
butan-2-yl (2R)-2-[(4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 176831019) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is butan-2-yl (2R)-2-[(4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | butan-2-yl (2R)-2-[(4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 176831019 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | butan-2-yl (2R)-2-[(4-ethynylbenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | C#Cc1ccc(C(=O)N[C@H](Cc2cnc[nH]2)C(=O)OC(C)CC)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-4-13(3)25-19(24)17(10-16-11-20-12-21-16)22-18(23)15-8-6-14(5-2)7-9-15/h2,6-9,11-13,17H,4,10H2,1,3H3,(H,20,21)(H,22,23)/t13?,17-/m1/s1 |
| InChIKey | STCGTGJPXAWLCC-LRHAYUFXSA-N |
| XLogP | 2.07 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|