C15H14N4O3 — CID 176830997
methyl (2R)-2-[(5-ethynylpyridine-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 176830997) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is methyl (2R)-2-[(5-ethynylpyridine-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2R)-2-[(5-ethynylpyridine-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 176830997 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl (2R)-2-[(5-ethynylpyridine-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | C#Cc1ccc(C(=O)N[C@H](Cc2cnc[nH]2)C(=O)OC)nc1 |
| InChI | InChI=1S/C15H14N4O3/c1-3-10-4-5-12(17-7-10)14(20)19-13(15(21)22-2)6-11-8-16-9-18-11/h1,4-5,7-9,13H,6H2,2H3,(H,16,18)(H,19,20)/t13-/m1/s1 |
| InChIKey | PNTGQBURUNNBLB-CYBMUJFWSA-N |
| XLogP | 0.30 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|