C9H7F3N2 — CID 176832469
6-isocyano-2,4-dimethyl-3-(trifluoromethyl)pyridine (PubChem CID 176832469) has the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. Its IUPAC name is 6-isocyano-2,4-dimethyl-3-(trifluoromethyl)pyridine.
| Compound Name | 6-isocyano-2,4-dimethyl-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 176832469 |
| Molecular Formula | C9H7F3N2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 6-isocyano-2,4-dimethyl-3-(trifluoromethyl)pyridine |
| SMILES | [C-]#[N+]c1cc(C)c(C(F)(F)F)c(C)n1 |
| InChI | InChI=1S/C9H7F3N2/c1-5-4-7(13-3)14-6(2)8(5)9(10,11)12/h4H,1-2H3 |
| InChIKey | NBUDVUFMHSXICF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|