C28H44ClN5O4S — CID 176833140
N-[5-(3-chloro-2-methoxycyclohexanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(5-cyano-2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide (PubChem CID 176833140) has the molecular formula C28H44ClN5O4S and a molecular weight of 582.21 g/mol. Its IUPAC name is N-[5-(3-chloro-2-methoxycyclohexanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(5-cyano-2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | N-[5-(3-chloro-2-methoxycyclohexanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(5-cyano-2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176833140 |
| Molecular Formula | C28H44ClN5O4S |
| Molecular Weight | 582.21 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | N-[5-(3-chloro-2-methoxycyclohexanecarbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(5-cyano-2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CCC(C#N)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3CCCC(Cl)C3OC)CC2S1 |
| InChI | InChI=1S/C28H44ClN5O4S/c1-15-9-18(19-10-16(11-30)7-8-23(19)37-2)20(12-31-15)26(35)33-28-32-22-13-34(14-24(22)39-28)27(36)17-5-4-6-21(29)25(17)38-3/h15-25,28,31-32H,4-10,12-14H2,1-3H3,(H,33,35) |
| InChIKey | OKGFYHLQZMNART-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|