C25H42N6O4S2 — CID 176833023
4-(5-cyano-2-methoxycyclohexyl)-N-[5-(cyclopentylsulfamoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 176833023) has the molecular formula C25H42N6O4S2 and a molecular weight of 554.78 g/mol. Its IUPAC name is 4-(5-cyano-2-methoxycyclohexyl)-N-[5-(cyclopentylsulfamoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 4-(5-cyano-2-methoxycyclohexyl)-N-[5-(cyclopentylsulfamoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176833023 |
| Molecular Formula | C25H42N6O4S2 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 4-(5-cyano-2-methoxycyclohexyl)-N-[5-(cyclopentylsulfamoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CCC(C#N)CC1C1CC(C)NCC1C(=O)NC1NC2CN(S(=O)(=O)NC3CCCC3)CC2S1 |
| InChI | InChI=1S/C25H42N6O4S2/c1-15-9-18(19-10-16(11-26)7-8-22(19)35-2)20(12-27-15)24(32)29-25-28-21-13-31(14-23(21)36-25)37(33,34)30-17-5-3-4-6-17/h15-23,25,27-28,30H,3-10,12-14H2,1-2H3,(H,29,32) |
| InChIKey | PNSRSRIFZNCPCY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |