C26H45ClN4O2S — CID 176832609
N-[5-(4-chlorocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide (PubChem CID 176832609) has the molecular formula C26H45ClN4O2S and a molecular weight of 513.19 g/mol. Its IUPAC name is N-[5-(4-chlorocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | N-[5-(4-chlorocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176832609 |
| Molecular Formula | C26H45ClN4O2S |
| Molecular Weight | 513.19 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | N-[5-(4-chlorocyclohexyl)-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CCCCC1C1CC(C)NCC1C(=O)NC1NC2CCN(C3CCC(Cl)CC3)CC2S1 |
| InChI | InChI=1S/C26H45ClN4O2S/c1-16-13-20(19-5-3-4-6-23(19)33-2)21(14-28-16)25(32)30-26-29-22-11-12-31(15-24(22)34-26)18-9-7-17(27)8-10-18/h16-24,26,28-29H,3-15H2,1-2H3,(H,30,32) |
| InChIKey | GCQYIMKQIZNRLY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|