C20H36N4O4S2 — CID 176832783
4-(2-methoxycyclohexyl)-6-methyl-N-(5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 176832783) has the molecular formula C20H36N4O4S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is 4-(2-methoxycyclohexyl)-6-methyl-N-(5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 4-(2-methoxycyclohexyl)-6-methyl-N-(5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 176832783 |
| Molecular Formula | C20H36N4O4S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 4-(2-methoxycyclohexyl)-6-methyl-N-(5-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | COC1CCCCC1C1CC(C)NCC1C(=O)NC1NC2CN(S(C)(=O)=O)CC2S1 |
| InChI | InChI=1S/C20H36N4O4S2/c1-12-8-14(13-6-4-5-7-17(13)28-2)15(9-21-12)19(25)23-20-22-16-10-24(30(3,26)27)11-18(16)29-20/h12-18,20-22H,4-11H2,1-3H3,(H,23,25) |
| InChIKey | PXRIFFDXGTXVGK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |