C21H36N4O4S — CID 176833589
methyl 2-[[4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carbonyl]amino]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate (PubChem CID 176833589) has the molecular formula C21H36N4O4S and a molecular weight of 440.61 g/mol. Its IUPAC name is methyl 2-[[4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carbonyl]amino]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate.
| Compound Name | methyl 2-[[4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carbonyl]amino]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 176833589 |
| Molecular Formula | C21H36N4O4S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | methyl 2-[[4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carbonyl]amino]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate |
| SMILES | COC(=O)N1CC2NC(NC(=O)C3CNC(C)CC3C3CCCCC3OC)SC2C1 |
| InChI | InChI=1S/C21H36N4O4S/c1-12-8-14(13-6-4-5-7-17(13)28-2)15(9-22-12)19(26)24-20-23-16-10-25(21(27)29-3)11-18(16)30-20/h12-18,20,22-23H,4-11H2,1-3H3,(H,24,26) |
| InChIKey | JBTFMFTWCJZWTG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |