C27H46ClN3O2S — CID 176834282
N-[6-(4-chlorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide (PubChem CID 176834282) has the molecular formula C27H46ClN3O2S and a molecular weight of 512.20 g/mol. Its IUPAC name is N-[6-(4-chlorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | N-[6-(4-chlorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176834282 |
| Molecular Formula | C27H46ClN3O2S |
| Molecular Weight | 512.20 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | N-[6-(4-chlorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-2-yl]-4-(2-methoxycyclohexyl)-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CCCCC1C1CC(C)NCC1C(=O)NC1NC2CCC(C3CCC(Cl)CC3)CC2S1 |
| InChI | InChI=1S/C27H46ClN3O2S/c1-16-13-21(20-5-3-4-6-24(20)33-2)22(15-29-16)26(32)31-27-30-23-12-9-18(14-25(23)34-27)17-7-10-19(28)11-8-17/h16-25,27,29-30H,3-15H2,1-2H3,(H,31,32) |
| InChIKey | BRKHZWRHDOBAAO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|