C18H33ClN2O — CID 176833900
4-(5-tert-butyl-2-cyclopropylpiperidin-4-yl)-2-chloro-5-methoxypiperidine (PubChem CID 176833900) has the molecular formula C18H33ClN2O and a molecular weight of 328.93 g/mol. Its IUPAC name is 4-(5-tert-butyl-2-cyclopropylpiperidin-4-yl)-2-chloro-5-methoxypiperidine.
| Compound Name | 4-(5-tert-butyl-2-cyclopropylpiperidin-4-yl)-2-chloro-5-methoxypiperidine |
|---|---|
| PubChem CID | 176833900 |
| Molecular Formula | C18H33ClN2O |
| Molecular Weight | 328.93 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 4-(5-tert-butyl-2-cyclopropylpiperidin-4-yl)-2-chloro-5-methoxypiperidine |
| SMILES | COC1CNC(Cl)CC1C1CC(C2CC2)NCC1C(C)(C)C |
| InChI | InChI=1S/C18H33ClN2O/c1-18(2,3)14-9-20-15(11-5-6-11)7-12(14)13-8-17(19)21-10-16(13)22-4/h11-17,20-21H,5-10H2,1-4H3 |
| InChIKey | YYRZIMYLMKKIEU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.93 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|