C6H11NO — CID 143686087
(5S)-4-methoxy-2-azabicyclo[3.1.0]hexane (PubChem CID 143686087) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (5S)-4-methoxy-2-azabicyclo[3.1.0]hexane.
| Compound Name | (5S)-4-methoxy-2-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143686087 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (5S)-4-methoxy-2-azabicyclo[3.1.0]hexane |
| SMILES | COC1CNC2C[C@@H]21 |
| InChI | InChI=1S/C6H11NO/c1-8-6-3-7-5-2-4(5)6/h4-7H,2-3H2,1H3/t4-,5?,6?/m0/s1 |
| InChIKey | AITCRSSLCZAIPN-KXGSVCODSA-N |
| XLogP | -0.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |