About 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane
9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane (PubChem CID 118068746) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane.
Molecular Properties
| Compound Name | 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane |
| PubChem CID | 118068746 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane |
| SMILES | CC1(C)C2CC3NCC1C3C2 |
| InChI | InChI=1S/C10H17N/c1-10(2)6-3-7-8(10)5-11-9(7)4-6/h6-9,11H,3-5H2,1-2H3 |
| InChIKey | JXHYLCPAEPHXOH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane?
The IUPAC name of 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane (CID 118068746) is 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane.
What is the SMILES notation for 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane?
The canonical SMILES for 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane is CC1(C)C2CC3NCC1C3C2.
What is the InChIKey of 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane?
The InChIKey is JXHYLCPAEPHXOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-10(2)6-3-7-8(10)5-11-9(7)4-6/h6-9,11H,3-5H2,1-2H3.
What are the key properties of 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane?
9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane has a molecular weight of 151.25 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethyl-4-azatricyclo[4.2.1.03,7]nonane is sourced from PubChem (CID 118068746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).