C24H39ClF3N7O3S — CID 176834433
4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-[2-(trifluoromethyl)-1,3-diazinane-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide (PubChem CID 176834433) has the molecular formula C24H39ClF3N7O3S and a molecular weight of 598.14 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-[2-(trifluoromethyl)-1,3-diazinane-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-[2-(trifluoromethyl)-1,3-diazinane-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 176834433 |
| Molecular Formula | C24H39ClF3N7O3S |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-[2-(trifluoromethyl)-1,3-diazinane-4-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3CCNC(C(F)(F)F)N3)CC2S1 |
| InChI | InChI=1S/C24H39ClF3N7O3S/c1-11-5-12(13-6-19(25)31-8-17(13)38-2)14(7-30-11)20(36)34-23-33-16-9-35(10-18(16)39-23)21(37)15-3-4-29-22(32-15)24(26,27)28/h11-19,22-23,29-33H,3-10H2,1-2H3,(H,34,36) |
| InChIKey | FZMYNTORLKXHLY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|