C25H41ClF3N7O4S — CID 176834376
4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-methoxy-5-(trifluoromethyl)piperazine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 176834376) has the molecular formula C25H41ClF3N7O4S and a molecular weight of 628.16 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-methoxy-5-(trifluoromethyl)piperazine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-methoxy-5-(trifluoromethyl)piperazine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176834376 |
| Molecular Formula | C25H41ClF3N7O4S |
| Molecular Weight | 628.16 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-methoxy-5-(trifluoromethyl)piperazine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3NCC(C(F)(F)F)NC3OC)CC2S1 |
| InChI | InChI=1S/C25H41ClF3N7O4S/c1-11-4-12(13-5-19(26)31-7-16(13)39-2)14(6-30-11)21(37)35-24-33-15-9-36(10-17(15)41-24)23(38)20-22(40-3)34-18(8-32-20)25(27,28)29/h11-20,22,24,30-34H,4-10H2,1-3H3,(H,35,37) |
| InChIKey | CBSNMKJUWWRGIA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|