C25H39Cl2F3N6O3S — CID 176833218
4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-chloro-5-(trifluoromethyl)piperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 176833218) has the molecular formula C25H39Cl2F3N6O3S and a molecular weight of 631.59 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-chloro-5-(trifluoromethyl)piperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-chloro-5-(trifluoromethyl)piperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176833218 |
| Molecular Formula | C25H39Cl2F3N6O3S |
| Molecular Weight | 631.59 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-N-[5-[3-chloro-5-(trifluoromethyl)piperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3NCC(C(F)(F)F)CC3Cl)CC2S1 |
| InChI | InChI=1S/C25H39Cl2F3N6O3S/c1-11-3-13(14-5-20(27)32-8-18(14)39-2)15(7-31-11)22(37)35-24-34-17-9-36(10-19(17)40-24)23(38)21-16(26)4-12(6-33-21)25(28,29)30/h11-21,24,31-34H,3-10H2,1-2H3,(H,35,37) |
| InChIKey | DTPOWTVYDUOKFU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.59 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|