C65H45N4OPtS-3 — CID 176843545
CID 176843545 (PubChem CID 176843545) has the molecular formula C65H45N4OPtS-3 and a molecular weight of 1125.25 g/mol.
| Compound Name | CID 176843545 |
|---|---|
| PubChem CID | 176843545 |
| Molecular Formula | C65H45N4OPtS-3 |
| Molecular Weight | 1125.25 g/mol |
| Exact Mass | 1124.30 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc65)ccc4)cc4c3c3c(cccc32)C42c3ccccc3Sc3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C65H45N4OS.Pt/c1-64(2,3)44-35-36-66-60(37-44)69-56-32-18-29-52-61(56)62-53(65(52)50-27-10-14-33-58(50)71-59-34-15-11-28-51(59)65)39-47(40-57(62)69)70-46-24-16-23-45(38-46)67-41-68(55-31-13-12-30-54(55)67)63-48(42-19-6-4-7-20-42)25-17-26-49(63)43-21-8-5-9-22-43;/h4-37,39,41H,1-3H3;/q-3; |
| InChIKey | FPGCPDWGVPJIHN-UHFFFAOYSA-N |
| XLogP | 16.77 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1125.25 |
| LogP ≤ 5 | 16.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|