C68H70BN4OPt-3 — CID 176843916
CID 176843916 (PubChem CID 176843916) has the molecular formula C68H70BN4OPt-3 and a molecular weight of 1165.22 g/mol.
| Compound Name | CID 176843916 |
|---|---|
| PubChem CID | 176843916 |
| Molecular Formula | C68H70BN4OPt-3 |
| Molecular Weight | 1165.22 g/mol |
| Exact Mass | 1164.53 |
| IUPAC Name | — |
| SMILES | CC(C)(C)B1c2cc(Oc3[c-]c(N4[CH-]N(c5c(-c6ccccc6)cc(C(C)(C)C)cc5-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccccc54)ccc3)[c-]c3c2c2c1cccc2n3-c1cc(C(C)(C)C)ccn1.[Pt] |
| InChI | InChI=1S/C68H70BN4O.Pt/c1-64(2,3)45-31-32-70-60(38-45)73-58-30-22-27-54-61(58)62-55(69(54)68(13,14)15)40-51(41-59(62)73)74-50-26-21-25-49(39-50)71-42-72(57-29-20-19-28-56(57)71)63-52(43-23-17-16-18-24-43)36-48(67(10,11)12)37-53(63)44-33-46(65(4,5)6)35-47(34-44)66(7,8)9;/h16-38,40,42H,1-15H3;/q-3; |
| InChIKey | SHWYDAQMXPRXQP-UHFFFAOYSA-N |
| XLogP | 17.22 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1165.22 |
| LogP ≤ 5 | 17.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|