C62H50N5OPt-3 — CID 176843870
CID 176843870 (PubChem CID 176843870) has the molecular formula C62H50N5OPt-3 and a molecular weight of 1076.19 g/mol.
| Compound Name | CID 176843870 |
|---|---|
| PubChem CID | 176843870 |
| Molecular Formula | C62H50N5OPt-3 |
| Molecular Weight | 1076.19 g/mol |
| Exact Mass | 1075.37 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccc(C(C)(C)C)cc65)ccc4)cc4c3c3c2cccc3n4-c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C62H50N5O.Pt/c1-61(2,3)43-31-32-51-54(35-43)64(40-65(51)60-49(41-19-10-7-11-20-41)27-17-28-50(60)42-21-12-8-13-22-42)46-25-16-26-47(37-46)68-48-38-55-59-56(39-48)67(57-36-44(33-34-63-57)62(4,5)6)53-30-18-29-52(58(53)59)66(55)45-23-14-9-15-24-45;/h7-36,38,40H,1-6H3;/q-3; |
| InChIKey | RRPBWYOMCCGBRZ-UHFFFAOYSA-N |
| XLogP | 16.29 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1076.19 |
| LogP ≤ 5 | 16.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|