C67H67N4OPt-3 — CID 176843474
CID 176843474 (PubChem CID 176843474) has the molecular formula C67H67N4OPt-3 and a molecular weight of 1145.41 g/mol.
| Compound Name | CID 176843474 |
|---|---|
| PubChem CID | 176843474 |
| Molecular Formula | C67H67N4OPt-3 |
| Molecular Weight | 1145.41 g/mol |
| Exact Mass | 1144.54 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2cc(Oc3[c-]c(N4[CH-]N(c5c(-c6ccccc6)cc(C(C)(C)C)cc5-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccccc54)ccc3)[c-]c3c2c2c1cccc2n3-c1cc(C(C)(C)C)ccn1.[Pt] |
| InChI | InChI=1S/C67H67N4O.Pt/c1-63(2,3)44-30-31-68-59(37-44)71-57-29-21-26-53-60(57)61-54(67(53,13)14)39-50(40-58(61)71)72-49-25-20-24-48(38-49)69-41-70(56-28-19-18-27-55(56)69)62-51(42-22-16-15-17-23-42)35-47(66(10,11)12)36-52(62)43-32-45(64(4,5)6)34-46(33-43)65(7,8)9;/h15-37,39,41H,1-14H3;/q-3;/i13D3,14D3; |
| InChIKey | XHGSFCKXPDBIOI-SJWAZBMRSA-N |
| XLogP | 18.14 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1145.41 |
| LogP ≤ 5 | 18.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|