C76H69N4O2PtSi-3 — CID 176843688
CID 176843688 (PubChem CID 176843688) has the molecular formula C76H69N4O2PtSi-3 and a molecular weight of 1293.58 g/mol.
| Compound Name | CID 176843688 |
|---|---|
| PubChem CID | 176843688 |
| Molecular Formula | C76H69N4O2PtSi-3 |
| Molecular Weight | 1293.58 g/mol |
| Exact Mass | 1292.49 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cccc(-c2cccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2N2[CH-]N(c3[c-]c(Oc4[c-]c5c6c(c4)[Si]4(c7ccccc7Oc7ccccc74)c4cccc(c46)n5-c4cc(C(C)(C)C)ccn4)ccc3)c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C76H69N4O2Si.Pt/c1-73(2,3)50-24-19-23-48(39-50)57-27-21-28-58(49-40-52(75(7,8)9)42-53(41-49)76(10,11)12)72(57)79-47-78(59-29-13-14-30-60(59)79)54-25-20-26-55(44-54)81-56-45-62-71-68(46-56)83(65-34-17-15-32-63(65)82-64-33-16-18-35-66(64)83)67-36-22-31-61(70(67)71)80(62)69-43-51(37-38-77-69)74(4,5)6;/h13-43,46-47H,1-12H3;/q-3; |
| InChIKey | CGHKLYCMUZKUJE-UHFFFAOYSA-N |
| XLogP | 17.30 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1293.58 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|