C68H70N4OPPt-3 — CID 176843620
CID 176843620 (PubChem CID 176843620) has the molecular formula C68H70N4OPPt-3 and a molecular weight of 1185.39 g/mol.
| Compound Name | CID 176843620 |
|---|---|
| PubChem CID | 176843620 |
| Molecular Formula | C68H70N4OPPt-3 |
| Molecular Weight | 1185.39 g/mol |
| Exact Mass | 1184.50 |
| IUPAC Name | — |
| SMILES | CCCCp1c2cc(Oc3[c-]c(N4[CH-]N(c5c(-c6ccccc6)cc(C(C)(C)C)cc5-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccccc54)ccc3)[c-]c3c2c2c(cccc21)n3-c1cc(C(C)(C)C)ccn1.[Pt] |
| InChI | InChI=1S/C68H70N4OP.Pt/c1-14-15-33-74-59-30-22-29-57-62(59)63-58(72(57)61-39-46(31-32-69-61)65(2,3)4)41-52(42-60(63)74)73-51-26-21-25-50(40-51)70-43-71(56-28-20-19-27-55(56)70)64-53(44-23-17-16-18-24-44)37-49(68(11,12)13)38-54(64)45-34-47(66(5,6)7)36-48(35-45)67(8,9)10;/h16-32,34-39,42-43H,14-15,33H2,1-13H3;/q-3; |
| InChIKey | DABCVEWMLNYELO-UHFFFAOYSA-N |
| XLogP | 19.88 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1185.39 |
| LogP ≤ 5 | 19.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|