C77H73N4OPt-3 — CID 176843872
CID 176843872 (PubChem CID 176843872) has the molecular formula C77H73N4OPt-3 and a molecular weight of 1265.54 g/mol.
| Compound Name | CID 176843872 |
|---|---|
| PubChem CID | 176843872 |
| Molecular Formula | C77H73N4OPt-3 |
| Molecular Weight | 1265.54 g/mol |
| Exact Mass | 1264.54 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(-c3ccccc3)c2N2[CH-]N(c3[c-]c(Oc4[c-]c5c6c(c4)C(c4ccccc4)(c4ccccc4)C4CC=Cc(c64)n5-c4cc(C(C)(C)C)ccn4)ccc3)c3ccccc32)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C77H73N4O.Pt/c1-73(2,3)54-38-39-78-69(45-54)81-67-37-25-34-63-70(67)71-64(77(63,52-28-18-14-19-29-52)53-30-20-15-21-31-53)47-60(48-68(71)81)82-59-33-24-32-58(46-59)79-49-80(66-36-23-22-35-65(66)79)72-61(50-26-16-13-17-27-50)43-57(76(10,11)12)44-62(72)51-40-55(74(4,5)6)42-56(41-51)75(7,8)9;/h13-33,35-45,47,49,63H,34H2,1-12H3;/q-3; |
| InChIKey | UERMMTIFLSWAMJ-UHFFFAOYSA-N |
| XLogP | 20.20 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1265.54 |
| LogP ≤ 5 | 20.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|