C77H71N4OPt-3 — CID 176844024
CID 176844024 (PubChem CID 176844024) has the molecular formula C77H71N4OPt-3 and a molecular weight of 1263.52 g/mol.
| Compound Name | CID 176844024 |
|---|---|
| PubChem CID | 176844024 |
| Molecular Formula | C77H71N4OPt-3 |
| Molecular Weight | 1263.52 g/mol |
| Exact Mass | 1262.53 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(-c3ccccc3)c2N2[CH-]N(c3[c-]c(Oc4[c-]c5c6c(c4)C4(c7ccccc7-c7ccccc74)C4CC=Cc(c64)n5-c4cc(C(C)(C)C)ccn4)ccc3)c3ccccc32)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C77H71N4O.Pt/c1-73(2,3)50-36-37-78-69(43-50)81-67-35-23-32-63-70(67)71-64(77(63)61-30-18-16-28-57(61)58-29-17-19-31-62(58)77)45-56(46-68(71)81)82-55-27-22-26-54(44-55)79-47-80(66-34-21-20-33-65(66)79)72-59(48-24-14-13-15-25-48)41-53(76(10,11)12)42-60(72)49-38-51(74(4,5)6)40-52(39-49)75(7,8)9;/h13-31,33-43,45,47,63H,32H2,1-12H3;/q-3; |
| InChIKey | BUQBHIRTVKIVEO-UHFFFAOYSA-N |
| XLogP | 20.18 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1263.52 |
| LogP ≤ 5 | 20.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|