C24H28ClFN2O4 — CID 176845528
methyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate (PubChem CID 176845528) has the molecular formula C24H28ClFN2O4 and a molecular weight of 462.95 g/mol. Its IUPAC name is methyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate.
| Compound Name | methyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 176845528 |
| Molecular Formula | C24H28ClFN2O4 |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | methyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate |
| SMILES | COC(=O)CCOCCOCCNCc1cc(F)cc2c1ccn2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28ClFN2O4/c1-30-24(29)7-10-31-12-13-32-11-8-27-16-19-14-21(26)15-23-22(19)6-9-28(23)17-18-2-4-20(25)5-3-18/h2-6,9,14-15,27H,7-8,10-13,16-17H2,1H3 |
| InChIKey | ZKFNBZBDDWSXMQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|