C31H33ClFN3O2 — CID 177193518
4-[4-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxymethyl]piperidin-1-yl]benzaldehyde (PubChem CID 177193518) has the molecular formula C31H33ClFN3O2 and a molecular weight of 534.08 g/mol. Its IUPAC name is 4-[4-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxymethyl]piperidin-1-yl]benzaldehyde.
| Compound Name | 4-[4-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxymethyl]piperidin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 177193518 |
| Molecular Formula | C31H33ClFN3O2 |
| Molecular Weight | 534.08 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 4-[4-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxymethyl]piperidin-1-yl]benzaldehyde |
| SMILES | O=Cc1ccc(N2CCC(COCCNCc3cc(F)cc4c3ccn4Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H33ClFN3O2/c32-27-5-1-23(2-6-27)20-36-15-11-30-26(17-28(33)18-31(30)36)19-34-12-16-38-22-25-9-13-35(14-10-25)29-7-3-24(21-37)4-8-29/h1-8,11,15,17-18,21,25,34H,9-10,12-14,16,19-20,22H2 |
| InChIKey | VCBIVLMDBKGDBQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.08 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|