C23H26ClFN2O3 — CID 177193385
2-[3-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]propoxy]acetaldehyde (PubChem CID 177193385) has the molecular formula C23H26ClFN2O3 and a molecular weight of 432.92 g/mol. Its IUPAC name is 2-[3-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]propoxy]acetaldehyde.
| Compound Name | 2-[3-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]propoxy]acetaldehyde |
|---|---|
| PubChem CID | 177193385 |
| Molecular Formula | C23H26ClFN2O3 |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[3-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]propoxy]acetaldehyde |
| SMILES | O=CCOCCCOCCNCc1cc(F)cc2c1ccn2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClFN2O3/c24-20-4-2-18(3-5-20)17-27-8-6-22-19(14-21(25)15-23(22)27)16-26-7-12-29-10-1-11-30-13-9-28/h2-6,8-9,14-15,26H,1,7,10-13,16-17H2 |
| InChIKey | ALWKHIYKQOEBAS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|