C27H34ClFN2O4 — CID 176845472
tert-butyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate (PubChem CID 176845472) has the molecular formula C27H34ClFN2O4 and a molecular weight of 505.03 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 176845472 |
| Molecular Formula | C27H34ClFN2O4 |
| Molecular Weight | 505.03 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | tert-butyl 3-[2-[2-[[1-[(4-chlorophenyl)methyl]-6-fluoroindol-4-yl]methylamino]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNCc1cc(F)cc2c1ccn2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H34ClFN2O4/c1-27(2,3)35-26(32)9-12-33-14-15-34-13-10-30-18-21-16-23(29)17-25-24(21)8-11-31(25)19-20-4-6-22(28)7-5-20/h4-8,11,16-17,30H,9-10,12-15,18-19H2,1-3H3 |
| InChIKey | FOOUBBTXZUXUCM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.03 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|