C25H26N8O — CID 176846346
3-[[5-[(3R)-3-aminopiperidin-1-yl]-2-(2-isocyano-4-methoxyphenyl)-4-pyridinyl]methyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 176846346) has the molecular formula C25H26N8O and a molecular weight of 454.54 g/mol. Its IUPAC name is 3-[[5-[(3R)-3-aminopiperidin-1-yl]-2-(2-isocyano-4-methoxyphenyl)-4-pyridinyl]methyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 3-[[5-[(3R)-3-aminopiperidin-1-yl]-2-(2-isocyano-4-methoxyphenyl)-4-pyridinyl]methyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 176846346 |
| Molecular Formula | C25H26N8O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 3-[[5-[(3R)-3-aminopiperidin-1-yl]-2-(2-isocyano-4-methoxyphenyl)-4-pyridinyl]methyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | [C-]#[N+]c1cc(OC)ccc1-c1cc(Cc2cnc3c(N)nccn23)c(N2CCC[C@@H](N)C2)cn1 |
| InChI | InChI=1S/C25H26N8O/c1-28-21-12-19(34-2)5-6-20(21)22-11-16(23(14-30-22)32-8-3-4-17(26)15-32)10-18-13-31-25-24(27)29-7-9-33(18)25/h5-7,9,11-14,17H,3-4,8,10,15,26H2,2H3,(H2,27,29)/t17-/m1/s1 |
| InChIKey | KZDCBSVQHIBEHO-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|