C24H23NO5 — CID 176849448
(E)-3-(3,4-dihydroxyphenyl)-N-[3-methoxy-4-(2-phenylethoxy)phenyl]prop-2-enamide (PubChem CID 176849448) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N-[3-methoxy-4-(2-phenylethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N-[3-methoxy-4-(2-phenylethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 176849448 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-[3-methoxy-4-(2-phenylethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc(O)c(O)c2)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C24H23NO5/c1-29-23-16-19(9-11-22(23)30-14-13-17-5-3-2-4-6-17)25-24(28)12-8-18-7-10-20(26)21(27)15-18/h2-12,15-16,26-27H,13-14H2,1H3,(H,25,28)/b12-8+ |
| InChIKey | FWZRYXMGTNQUMA-XYOKQWHBSA-N |
| XLogP | 4.38 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|