C27H38BFO2Si — CID 176855131
[2-(7-fluoro-8-prop-1-ynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-tri(propan-2-yl)silane (PubChem CID 176855131) has the molecular formula C27H38BFO2Si and a molecular weight of 452.50 g/mol. Its IUPAC name is [2-(7-fluoro-8-prop-1-ynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-tri(propan-2-yl)silane.
| Compound Name | [2-(7-fluoro-8-prop-1-ynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 176855131 |
| Molecular Formula | C27H38BFO2Si |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | [2-(7-fluoro-8-prop-1-ynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]-tri(propan-2-yl)silane |
| SMILES | CC#Cc1c(F)ccc2cccc(B3OC(C)(C)C(C)([Si](C(C)C)(C(C)C)C(C)C)O3)c12 |
| InChI | InChI=1S/C27H38BFO2Si/c1-11-13-22-24(29)17-16-21-14-12-15-23(25(21)22)28-30-26(8,9)27(10,31-28)32(18(2)3,19(4)5)20(6)7/h12,14-20H,1-10H3 |
| InChIKey | ZYJGMHSIEXSHOJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|