C21H29F2N3O3 — CID 176862240
N-[4-[[3-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxy]butyl]acetamide (PubChem CID 176862240) has the molecular formula C21H29F2N3O3 and a molecular weight of 409.48 g/mol. Its IUPAC name is N-[4-[[3-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxy]butyl]acetamide.
| Compound Name | N-[4-[[3-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxy]butyl]acetamide |
|---|---|
| PubChem CID | 176862240 |
| Molecular Formula | C21H29F2N3O3 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[4-[[3-[2-[(3S)-3-(difluoromethoxy)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxy]butyl]acetamide |
| SMILES | CC(=O)NCCCCOc1ccc2[nH]cc(CCN3CC[C@H](OC(F)F)C3)c2c1 |
| InChI | InChI=1S/C21H29F2N3O3/c1-15(27)24-8-2-3-11-28-17-4-5-20-19(12-17)16(13-25-20)6-9-26-10-7-18(14-26)29-21(22)23/h4-5,12-13,18,21,25H,2-3,6-11,14H2,1H3,(H,24,27)/t18-/m0/s1 |
| InChIKey | HUSGQXFCTXYERX-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|