C20H29F2N3O4 — CID 176862175
methyl N-[4-[[3-[2-[2-(difluoromethoxy)ethyl-methylamino]ethyl]-1H-indol-5-yl]oxy]butyl]carbamate (PubChem CID 176862175) has the molecular formula C20H29F2N3O4 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl N-[4-[[3-[2-[2-(difluoromethoxy)ethyl-methylamino]ethyl]-1H-indol-5-yl]oxy]butyl]carbamate.
| Compound Name | methyl N-[4-[[3-[2-[2-(difluoromethoxy)ethyl-methylamino]ethyl]-1H-indol-5-yl]oxy]butyl]carbamate |
|---|---|
| PubChem CID | 176862175 |
| Molecular Formula | C20H29F2N3O4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | methyl N-[4-[[3-[2-[2-(difluoromethoxy)ethyl-methylamino]ethyl]-1H-indol-5-yl]oxy]butyl]carbamate |
| SMILES | COC(=O)NCCCCOc1ccc2[nH]cc(CCN(C)CCOC(F)F)c2c1 |
| InChI | InChI=1S/C20H29F2N3O4/c1-25(10-12-29-19(21)22)9-7-15-14-24-18-6-5-16(13-17(15)18)28-11-4-3-8-23-20(26)27-2/h5-6,13-14,19,24H,3-4,7-12H2,1-2H3,(H,23,26) |
| InChIKey | MQTQODXTLIJKCT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|