C16H22N2OS — CID 176862227
3-[2-[(3R)-3-methoxypyrrolidin-1-yl]ethyl]-5-methylsulfanyl-1H-indole (PubChem CID 176862227) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 3-[2-[(3R)-3-methoxypyrrolidin-1-yl]ethyl]-5-methylsulfanyl-1H-indole.
| Compound Name | 3-[2-[(3R)-3-methoxypyrrolidin-1-yl]ethyl]-5-methylsulfanyl-1H-indole |
|---|---|
| PubChem CID | 176862227 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-[2-[(3R)-3-methoxypyrrolidin-1-yl]ethyl]-5-methylsulfanyl-1H-indole |
| SMILES | CO[C@@H]1CCN(CCc2c[nH]c3ccc(SC)cc23)C1 |
| InChI | InChI=1S/C16H22N2OS/c1-19-13-6-8-18(11-13)7-5-12-10-17-16-4-3-14(20-2)9-15(12)16/h3-4,9-10,13,17H,5-8,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | NJUUGUFUVXKSBE-CYBMUJFWSA-N |
| XLogP | 3.15 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |