C18H22N2S — CID 176854869
3-[[(2R)-1-but-2-ynylpyrrolidin-2-yl]methyl]-5-methylsulfanyl-1H-indole (PubChem CID 176854869) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is 3-[[(2R)-1-but-2-ynylpyrrolidin-2-yl]methyl]-5-methylsulfanyl-1H-indole.
| Compound Name | 3-[[(2R)-1-but-2-ynylpyrrolidin-2-yl]methyl]-5-methylsulfanyl-1H-indole |
|---|---|
| PubChem CID | 176854869 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-[[(2R)-1-but-2-ynylpyrrolidin-2-yl]methyl]-5-methylsulfanyl-1H-indole |
| SMILES | CC#CCN1CCC[C@@H]1Cc1c[nH]c2ccc(SC)cc12 |
| InChI | InChI=1S/C18H22N2S/c1-3-4-9-20-10-5-6-15(20)11-14-13-19-18-8-7-16(21-2)12-17(14)18/h7-8,12-13,15,19H,5-6,9-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | JCQAVCGAYPBQKU-OAHLLOKOSA-N |
| XLogP | 3.92 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|