C20H23N3S — CID 176854792
5-methylsulfanyl-3-[[(2R)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 176854792) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 5-methylsulfanyl-3-[[(2R)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 5-methylsulfanyl-3-[[(2R)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 176854792 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 5-methylsulfanyl-3-[[(2R)-1-(pyridin-2-ylmethyl)pyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | CSc1ccc2[nH]cc(C[C@H]3CCCN3Cc3ccccn3)c2c1 |
| InChI | InChI=1S/C20H23N3S/c1-24-18-7-8-20-19(12-18)15(13-22-20)11-17-6-4-10-23(17)14-16-5-2-3-9-21-16/h2-3,5,7-9,12-13,17,22H,4,6,10-11,14H2,1H3/t17-/m1/s1 |
| InChIKey | CSTHOLWWEUQOST-QGZVFWFLSA-N |
| XLogP | 4.49 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |