C9H11N3O2 — CID 176864115
N-[2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]formamide (PubChem CID 176864115) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is N-[2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]formamide.
| Compound Name | N-[2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]formamide |
|---|---|
| PubChem CID | 176864115 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]formamide |
| SMILES | N#C[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)CNC=O |
| InChI | InChI=1S/C9H11N3O2/c10-3-7-1-6-2-8(6)12(7)9(14)4-11-5-13/h5-8H,1-2,4H2,(H,11,13)/t6-,7+,8+/m1/s1 |
| InChIKey | SOEXFWLABRDKGJ-CSMHCCOUSA-N |
| XLogP | -0.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|