C18H29N3O2 — CID 118461107
(2S,4S)-1-[2-[[(3aS,6aR)-5-hydroxy-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4,5-dimethylpyrrolidine-2-carbonitrile (PubChem CID 118461107) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2S,4S)-1-[2-[[(3aS,6aR)-5-hydroxy-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4,5-dimethylpyrrolidine-2-carbonitrile.
| Compound Name | (2S,4S)-1-[2-[[(3aS,6aR)-5-hydroxy-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4,5-dimethylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 118461107 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2S,4S)-1-[2-[[(3aS,6aR)-5-hydroxy-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-yl]amino]acetyl]-4,5-dimethylpyrrolidine-2-carbonitrile |
| SMILES | CC1[C@@H](C)C[C@@H](C#N)N1C(=O)CNC1(C)C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C18H29N3O2/c1-11-4-15(9-19)21(12(11)2)17(23)10-20-18(3)7-13-5-16(22)6-14(13)8-18/h11-16,20,22H,4-8,10H2,1-3H3/t11-,12?,13-,14+,15-,16?,18?/m0/s1 |
| InChIKey | SJLCNKIKOMXSKG-JDTFQAANSA-N |
| XLogP | 1.66 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |