C56H54N12S8 — CID 176876883
1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-ethyl-1,3-thiazol-5-yl)pyrene-1,3,6,8-tetramine (PubChem CID 176876883) has the molecular formula C56H54N12S8 and a molecular weight of 1151.67 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-ethyl-1,3-thiazol-5-yl)pyrene-1,3,6,8-tetramine.
| Compound Name | 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-ethyl-1,3-thiazol-5-yl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 176876883 |
| Molecular Formula | C56H54N12S8 |
| Molecular Weight | 1151.67 g/mol |
| Exact Mass | 1150.24 |
| IUPAC Name | 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(4-ethyl-1,3-thiazol-5-yl)pyrene-1,3,6,8-tetramine |
| SMILES | CCc1ncsc1N(c1scnc1CC)c1cc(N(c2scnc2CC)c2scnc2CC)c2ccc3c(N(c4scnc4CC)c4scnc4CC)cc(N(c4scnc4CC)c4scnc4CC)c4ccc1c2c43 |
| InChI | InChI=1S/C56H54N12S8/c1-9-35-49(69-23-57-35)65(50-36(10-2)58-24-70-50)43-21-44(66(51-37(11-3)59-25-71-51)52-38(12-4)60-26-72-52)32-19-20-34-46(68(55-41(15-7)63-29-75-55)56-42(16-8)64-30-76-56)22-45(33-18-17-31(43)47(32)48(33)34)67(53-39(13-5)61-27-73-53)54-40(14-6)62-28-74-54/h17-30H,9-16H2,1-8H3 |
| InChIKey | SOWMHWHAWOADQO-UHFFFAOYSA-N |
| XLogP | 18.61 |
| TPSA | 116.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1151.67 |
| LogP ≤ 5 | 18.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|