C35H39FN6O3 — CID 176877423
4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-morpholin-4-ylcyclopropyl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5,6,7,8-tetrahydrophenanthren-2-ol (PubChem CID 176877423) has the molecular formula C35H39FN6O3 and a molecular weight of 610.73 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-morpholin-4-ylcyclopropyl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5,6,7,8-tetrahydrophenanthren-2-ol.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-morpholin-4-ylcyclopropyl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5,6,7,8-tetrahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 176877423 |
| Molecular Formula | C35H39FN6O3 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[(1-morpholin-4-ylcyclopropyl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5,6,7,8-tetrahydrophenanthren-2-ol |
| SMILES | Oc1cc(-c2ncc3c(N4CC5CCC(C4)N5)nc(OCC4(N5CCOCC5)CC4)nc3c2F)c2c3c(ccc2c1)CCCC3 |
| InChI | InChI=1S/C35H39FN6O3/c36-30-31(27-16-25(43)15-22-6-5-21-3-1-2-4-26(21)29(22)27)37-17-28-32(30)39-34(40-33(28)41-18-23-7-8-24(19-41)38-23)45-20-35(9-10-35)42-11-13-44-14-12-42/h5-6,15-17,23-24,38,43H,1-4,7-14,18-20H2 |
| InChIKey | OREILPOSFRSXNA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |