C26H20F3O5S- — CID 176879396
5-methyl-4-(16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2-(trifluoromethyl)benzenesulfonate (PubChem CID 176879396) has the molecular formula C26H20F3O5S- and a molecular weight of 501.50 g/mol. Its IUPAC name is 5-methyl-4-(16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2-(trifluoromethyl)benzenesulfonate.
| Compound Name | 5-methyl-4-(16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 176879396 |
| Molecular Formula | C26H20F3O5S- |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 5-methyl-4-(16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-2-(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)[O-])c(C(F)(F)F)cc1OC(=O)C1C2c3ccccc3C(c3ccccc32)C1C |
| InChI | InChI=1S/C26H21F3O5S/c1-13-11-21(35(31,32)33)19(26(27,28)29)12-20(13)34-25(30)23-14(2)22-15-7-3-5-9-17(15)24(23)18-10-6-4-8-16(18)22/h3-12,14,22-24H,1-2H3,(H,31,32,33)/p-1 |
| InChIKey | YWPRLNKGOZGKSV-UHFFFAOYSA-M |
| XLogP | 5.37 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|