C38H32N2S4 — CID 176881263
3,8-di(propan-2-yl)-1-N,1-N,6-N,6-N-tetrathiophen-2-ylpyrene-1,6-diamine (PubChem CID 176881263) has the molecular formula C38H32N2S4 and a molecular weight of 644.96 g/mol. Its IUPAC name is 3,8-di(propan-2-yl)-1-N,1-N,6-N,6-N-tetrathiophen-2-ylpyrene-1,6-diamine.
| Compound Name | 3,8-di(propan-2-yl)-1-N,1-N,6-N,6-N-tetrathiophen-2-ylpyrene-1,6-diamine |
|---|---|
| PubChem CID | 176881263 |
| Molecular Formula | C38H32N2S4 |
| Molecular Weight | 644.96 g/mol |
| Exact Mass | 644.14 |
| IUPAC Name | 3,8-di(propan-2-yl)-1-N,1-N,6-N,6-N-tetrathiophen-2-ylpyrene-1,6-diamine |
| SMILES | CC(C)c1cc(N(c2cccs2)c2cccs2)c2ccc3c(C(C)C)cc(N(c4cccs4)c4cccs4)c4ccc1c2c34 |
| InChI | InChI=1S/C38H32N2S4/c1-23(2)29-21-31(39(33-9-5-17-41-33)34-10-6-18-42-34)27-16-14-26-30(24(3)4)22-32(28-15-13-25(29)37(27)38(26)28)40(35-11-7-19-43-35)36-12-8-20-44-36/h5-24H,1-4H3 |
| InChIKey | QNTVWJJHZGMNRH-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.96 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|