C14H14F2N2O6S — CID 176885294
(1S,2S,5R)-3-(3,4-difluorophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylic acid (PubChem CID 176885294) has the molecular formula C14H14F2N2O6S and a molecular weight of 376.34 g/mol. Its IUPAC name is (1S,2S,5R)-3-(3,4-difluorophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylic acid.
| Compound Name | (1S,2S,5R)-3-(3,4-difluorophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylic acid |
|---|---|
| PubChem CID | 176885294 |
| Molecular Formula | C14H14F2N2O6S |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (1S,2S,5R)-3-(3,4-difluorophenyl)sulfonyl-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H]2CC[C@H](CN1S(=O)(=O)c1ccc(F)c(F)c1)N2C(=O)O |
| InChI | InChI=1S/C14H14F2N2O6S/c15-9-3-2-8(5-10(9)16)25(23,24)17-6-7-1-4-11(12(17)13(19)20)18(7)14(21)22/h2-3,5,7,11-12H,1,4,6H2,(H,19,20)(H,21,22)/t7-,11+,12+/m1/s1 |
| InChIKey | QSKIEJZLVYZBHW-MKCWBWRRSA-N |
| XLogP | 0.93 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |