C24H26FN3O4 — CID 176895351
7-(3-fluoro-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 176895351) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is 7-(3-fluoro-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 7-(3-fluoro-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 176895351 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 7-(3-fluoro-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | COc1ccc(C2CCc3c(ncnc3Nc3cc(OC)c(OC)c(OC)c3)C2)cc1F |
| InChI | InChI=1S/C24H26FN3O4/c1-29-20-8-6-14(9-18(20)25)15-5-7-17-19(10-15)26-13-27-24(17)28-16-11-21(30-2)23(32-4)22(12-16)31-3/h6,8-9,11-13,15H,5,7,10H2,1-4H3,(H,26,27,28) |
| InChIKey | RKXDVKSITYTNDA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |