C16H32O6 — CID 176900020
3,3-bis(2-methylbutan-2-ylperoxy)butyl acetate (PubChem CID 176900020) has the molecular formula C16H32O6 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3,3-bis(2-methylbutan-2-ylperoxy)butyl acetate.
| Compound Name | 3,3-bis(2-methylbutan-2-ylperoxy)butyl acetate |
|---|---|
| PubChem CID | 176900020 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3,3-bis(2-methylbutan-2-ylperoxy)butyl acetate |
| SMILES | CCC(C)(C)OOC(C)(CCOC(C)=O)OOC(C)(C)CC |
| InChI | InChI=1S/C16H32O6/c1-9-14(4,5)19-21-16(8,11-12-18-13(3)17)22-20-15(6,7)10-2/h9-12H2,1-8H3 |
| InChIKey | CPFSVASIQGBGSK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|