C23H28BrN3O4 — CID 176901942
tert-butyl 3-[(2-bromo-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 176901942) has the molecular formula C23H28BrN3O4 and a molecular weight of 490.40 g/mol. Its IUPAC name is tert-butyl 3-[(2-bromo-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-bromo-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176901942 |
| Molecular Formula | C23H28BrN3O4 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | tert-butyl 3-[(2-bromo-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(CN(C(=O)C2CCN(C(=O)OC(C)(C)C)C2)c2cccnc2Br)cc1 |
| InChI | InChI=1S/C23H28BrN3O4/c1-23(2,3)31-22(29)26-13-11-17(15-26)21(28)27(19-6-5-12-25-20(19)24)14-16-7-9-18(30-4)10-8-16/h5-10,12,17H,11,13-15H2,1-4H3 |
| InChIKey | HJRIKCRFLFHWAG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|