C32H37F3N2O9S — CID 176903786
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(2-oxochromen-7-yl)phenyl]butyl]sulfonyliminobutanoate (PubChem CID 176903786) has the molecular formula C32H37F3N2O9S and a molecular weight of 682.71 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(2-oxochromen-7-yl)phenyl]butyl]sulfonyliminobutanoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(2-oxochromen-7-yl)phenyl]butyl]sulfonyliminobutanoate |
|---|---|
| PubChem CID | 176903786 |
| Molecular Formula | C32H37F3N2O9S |
| Molecular Weight | 682.71 g/mol |
| Exact Mass | 682.22 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(2-oxochromen-7-yl)phenyl]butyl]sulfonyliminobutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=NS(=O)(=O)CCC(O)(c1ccc(-c2ccc3ccc(=O)oc3c2)cc1)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H37F3N2O9S/c1-29(2,3)45-27(39)24(37-28(40)46-30(4,5)6)15-17-36-47(42,43)18-16-31(41,32(33,34)35)23-12-9-20(10-13-23)22-8-7-21-11-14-26(38)44-25(21)19-22/h7-14,17,19,24,41H,15-16,18H2,1-6H3,(H,37,40)/t24-,31?/m0/s1 |
| InChIKey | KTFQTJYZACYSGI-ACXKHFGCSA-N |
| XLogP | 5.63 |
| TPSA | 161.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|