C31H37F3N2O6S — CID 176903972
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[4-(2-phenylethynyl)phenyl]butyl]sulfonyliminobutanoate (PubChem CID 176903972) has the molecular formula C31H37F3N2O6S and a molecular weight of 622.71 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[4-(2-phenylethynyl)phenyl]butyl]sulfonyliminobutanoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[4-(2-phenylethynyl)phenyl]butyl]sulfonyliminobutanoate |
|---|---|
| PubChem CID | 176903972 |
| Molecular Formula | C31H37F3N2O6S |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4,4,4-trifluoro-3-[4-(2-phenylethynyl)phenyl]butyl]sulfonyliminobutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=NS(=O)(=O)CCC(c1ccc(C#Cc2ccccc2)cc1)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H37F3N2O6S/c1-29(2,3)41-27(37)26(36-28(38)42-30(4,5)6)18-20-35-43(39,40)21-19-25(31(32,33)34)24-16-14-23(15-17-24)13-12-22-10-8-7-9-11-22/h7-11,14-17,20,25-26H,18-19,21H2,1-6H3,(H,36,38)/t25?,26-/m0/s1 |
| InChIKey | PIQRRZJOXVPTHV-AMVUTOCUSA-N |
| XLogP | 6.15 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|