C14H16FN3O4S — CID 176907187
[(E)-2-fluoro-3-[1-[(4-methoxyphenyl)methyl]triazol-4-yl]prop-2-enyl] methanesulfonate (PubChem CID 176907187) has the molecular formula C14H16FN3O4S and a molecular weight of 341.36 g/mol. Its IUPAC name is [(E)-2-fluoro-3-[1-[(4-methoxyphenyl)methyl]triazol-4-yl]prop-2-enyl] methanesulfonate.
| Compound Name | [(E)-2-fluoro-3-[1-[(4-methoxyphenyl)methyl]triazol-4-yl]prop-2-enyl] methanesulfonate |
|---|---|
| PubChem CID | 176907187 |
| Molecular Formula | C14H16FN3O4S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | [(E)-2-fluoro-3-[1-[(4-methoxyphenyl)methyl]triazol-4-yl]prop-2-enyl] methanesulfonate |
| SMILES | COc1ccc(Cn2cc(/C=C(/F)COS(C)(=O)=O)nn2)cc1 |
| InChI | InChI=1S/C14H16FN3O4S/c1-21-14-5-3-11(4-6-14)8-18-9-13(16-17-18)7-12(15)10-22-23(2,19)20/h3-7,9H,8,10H2,1-2H3/b12-7+ |
| InChIKey | OXGJARFNXIBQKG-KPKJPENVSA-N |
| XLogP | 1.62 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|