C19H30N2O5 — CID 176912718
[1-hydroxy-6-[(2-methyl-4-phenylbutan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid (PubChem CID 176912718) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is [1-hydroxy-6-[(2-methyl-4-phenylbutan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid.
| Compound Name | [1-hydroxy-6-[(2-methyl-4-phenylbutan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 176912718 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [1-hydroxy-6-[(2-methyl-4-phenylbutan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid |
| SMILES | CC(C)(CCc1ccccc1)OC(=O)NCCCCC(CO)NC(=O)O |
| InChI | InChI=1S/C19H30N2O5/c1-19(2,12-11-15-8-4-3-5-9-15)26-18(25)20-13-7-6-10-16(14-22)21-17(23)24/h3-5,8-9,16,21-22H,6-7,10-14H2,1-2H3,(H,20,25)(H,23,24) |
| InChIKey | UGIFGKHABXYZFA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|